CAS 38727-03-6 is the registry number for DL-Amphetamine Mesylate. Offered by: TRC. Available pack sizes: 250mg.
Methanesulfonic acid;1-phenylpropan-2-amine (CAS 38727-03-6) is a chemical compound with the molecular formula C10H17NO3S and a molecular weight of 231.31 g/mol. IUPAC name: methanesulfonic acid;1-phenylpropan-2-amine. InChIKey: MXNLPUKSUIQAGM-UHFFFAOYSA-N.
| Molecular formula | C10H17NO3S |
|---|---|
| Molecular weight | 231.31 g/mol |
| IUPAC name | methanesulfonic acid;1-phenylpropan-2-amine |
| InChIKey | MXNLPUKSUIQAGM-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=CC=C1)N.CS(=O)(=O)O |
Computed by PubChem (NCBI)