CAS 176036-41-2 appears in our catalog under these names: methyl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate, 95%, Captopril Methyl Ester. Offered by: Combi-blocks, Mikromol. Available pack sizes: 5g, 1g, 100mg.
Methyl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate (CAS 176036-41-2) is a chemical compound with the molecular formula C10H17NO3S and a molecular weight of 231.31 g/mol. IUPAC name: methyl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate. InChIKey: NJJLWDSRKWBYRY-SFYZADRCSA-N.
| Molecular formula | C10H17NO3S |
|---|---|
| Molecular weight | 231.31 g/mol |
| IUPAC name | methyl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate |
| InChIKey | NJJLWDSRKWBYRY-SFYZADRCSA-N |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)