Products 1544315-61-8

CAS 1544315-61-8 is the registry number for 4-((Tetrahydrofuran-2-yl)methyl)thiomorpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(oxolan-2-ylmethyl)thiomorpholine-3-carboxylic acid (CAS 1544315-61-8) is a chemical compound with the molecular formula C10H17NO3S and a molecular weight of 231.31 g/mol. IUPAC name: 4-(oxolan-2-ylmethyl)thiomorpholine-3-carboxylic acid. InChIKey: RNYOCLPXDYDDEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO3S
Molecular weight231.31 g/mol
IUPAC name4-(oxolan-2-ylmethyl)thiomorpholine-3-carboxylic acid
InChIKeyRNYOCLPXDYDDEJ-UHFFFAOYSA-N
SMILESC1CC(OC1)CN2CCSCC2C(=O)O

Computed by PubChem (NCBI)