Products 174909-66-1

CAS 174909-66-1 is the registry number for 1-(3-Mercaptopropanoyl)-6-methylpiperidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

6-methyl-1-(3-sulfanylpropanoyl)piperidine-2-carboxylic acid (CAS 174909-66-1) is a chemical compound with the molecular formula C10H17NO3S and a molecular weight of 231.31 g/mol. IUPAC name: 6-methyl-1-(3-sulfanylpropanoyl)piperidine-2-carboxylic acid. InChIKey: UHIOKYGCFGNNCU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO3S
Molecular weight231.31 g/mol
IUPAC name6-methyl-1-(3-sulfanylpropanoyl)piperidine-2-carboxylic acid
InChIKeyUHIOKYGCFGNNCU-UHFFFAOYSA-N
SMILESCC1CCCC(N1C(=O)CCS)C(=O)O

Computed by PubChem (NCBI)