Products 1544414-78-9

CAS 1544414-78-9 is the registry number for 4-(2,2-Dimethylpropanoyl)thiomorpholine-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2,2-dimethylpropanoyl)thiomorpholine-3-carboxylic acid (CAS 1544414-78-9) is a chemical compound with the molecular formula C10H17NO3S and a molecular weight of 231.31 g/mol. IUPAC name: 4-(2,2-dimethylpropanoyl)thiomorpholine-3-carboxylic acid. InChIKey: XJVVYMGPADEPGI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO3S
Molecular weight231.31 g/mol
IUPAC name4-(2,2-dimethylpropanoyl)thiomorpholine-3-carboxylic acid
InChIKeyXJVVYMGPADEPGI-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)N1CCSCC1C(=O)O

Computed by PubChem (NCBI)