CAS 58112-19-9 is the registry number for (S)-2-Amino-N-(2,4-dichlorophenyl)propanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-N-(2,4-dichlorophenyl)propanamide (CAS 58112-19-9) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: (2S)-2-amino-N-(2,4-dichlorophenyl)propanamide. InChIKey: WYFYOSYEETWHQE-YFKPBYRVSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | (2S)-2-amino-N-(2,4-dichlorophenyl)propanamide |
| InChIKey | WYFYOSYEETWHQE-YFKPBYRVSA-N |
| SMILES | C[C@@H](C(=O)NC1=C(C=C(C=C1)Cl)Cl)N |
Computed by PubChem (NCBI)