Products 938517-66-9
CAS 938517-66-9 is the registry number for 3-Amino-N-(3,5-dichlorophenyl)propanamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-amino-N-(3,5-dichlorophenyl)propanamide (CAS 938517-66-9) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: 3-amino-N-(3,5-dichlorophenyl)propanamide. InChIKey: MMTFIYIUMLTOJF-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 3-amino-N-(3,5-dichlorophenyl)propanamide |
| InChIKey | MMTFIYIUMLTOJF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)NC(=O)CCN |
Computed by PubChem (NCBI)