Products 1158342-05-2

CAS 1158342-05-2 is the registry number for 3-((2-Methoxyethyl)(methyl)amino)propanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[2-methoxyethyl(methyl)amino]propanoic acid;hydrochloride (CAS 1158342-05-2) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: 3-[2-methoxyethyl(methyl)amino]propanoic acid;hydrochloride. InChIKey: DDYHVYYQZMFPJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16ClNO3
Molecular weight197.66 g/mol
IUPAC name3-[2-methoxyethyl(methyl)amino]propanoic acid;hydrochloride
InChIKeyDDYHVYYQZMFPJQ-UHFFFAOYSA-N
SMILESCN(CCC(=O)O)CCOC.Cl

Computed by PubChem (NCBI)