Products 131528-45-5
CAS 131528-45-5 appears in our catalog under these names: (2S,3S,4S,6R)-4-Amino-6-methoxy-2-methyltetrahydro-2H-pyran-3-ol hydrochloride, 98%, Methyl L-Daunosamine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5mg, 25mg.
(2S,3S,4S)-4-amino-6-methoxy-2-methyloxan-3-ol;hydrochloride (CAS 131528-45-5) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: (2S,3S,4S)-4-amino-6-methoxy-2-methyloxan-3-ol;hydrochloride. InChIKey: JVYGBUAXDCLPMP-KKVABMMESA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | (2S,3S,4S)-4-amino-6-methoxy-2-methyloxan-3-ol;hydrochloride |
| InChIKey | JVYGBUAXDCLPMP-KKVABMMESA-N |
| SMILES | C[C@H]1[C@H]([C@H](CC(O1)OC)N)O.Cl |
Computed by PubChem (NCBI)