CAS 32385-06-1 is the registry number for Methyl Alpha-L-Daunosamine Hydrochloride (Alpha:Beta approx. 85:15). Offered by: TRC. Available pack sizes: 10mg, 50mg.
(2S,3S,4S,6R)-4-amino-6-methoxy-2-methyloxan-3-ol;hydrochloride (CAS 32385-06-1) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: (2S,3S,4S,6R)-4-amino-6-methoxy-2-methyloxan-3-ol;hydrochloride. InChIKey: JVYGBUAXDCLPMP-AOAPYHFMSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | (2S,3S,4S,6R)-4-amino-6-methoxy-2-methyloxan-3-ol;hydrochloride |
| InChIKey | JVYGBUAXDCLPMP-AOAPYHFMSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)OC)N)O.Cl |
Computed by PubChem (NCBI)