CAS 106402-41-9 appears in our catalog under these names: L-Serine 1,1-Dimethylethyl Ester Hydrochloride, L-Serine tert-butyl ester hydrochloride, H-Ser-OtBu·HCl 97%, tert-Butyl L-serinate hydrochloride, 98%, 98%, h-ser.otbu.hcl, 95%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 5000mg, 2000mg, 10000mg, 100mg, 250mg, 1g, 10g.
Tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride (CAS 106402-41-9) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride. InChIKey: TUDHOGYHZNNYHW-JEDNCBNOSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride |
| InChIKey | TUDHOGYHZNNYHW-JEDNCBNOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)