Products 350818-62-1
CAS 350818-62-1 appears in our catalog under these names: L–Carnitine–d3 (chloride), L-Carnitine-d3 Chloride, L-Carnitine-d3 HCl (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, L-Carnitine-d3 Chloride, >95% (HPLC), L-Carnitine-d3 (hydrochloride), 99.9%. Offered by: GLPBio, Chemat Brand, CDN, TRC, TargetMol. Available pack sizes: 1mg, on request, 0,25g, 0,1g, 100mg, 50mg, 5mg, 10mg.
[(2R)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride (CAS 350818-62-1) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 200.68 g/mol. IUPAC name: [(2R)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride. InChIKey: JXXCENBLGFBQJM-QKBJTWEASA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 200.68 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
| InChIKey | JXXCENBLGFBQJM-QKBJTWEASA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)O.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
(2R)-3-Carboxy-2-hydroxy-N,N-dimethyl-N-(~2~H_3_)methylpropan-1-aminium chloride, L-Carnitine-d3 Chloride, L-Carnitine-d3 (hydrochloride), L-Carnitine-d3 HCl (N-methyl-d3), L-Carnitine-d3 (chloride), [(2R)-3-Carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium;chloride, l-carnitine-d3 hydrochloride, (2R)-3-Carboxy-2-hydroxy-N,N-dimethyl-N-(methyl-d3)-1-propanaminium Chloride, orb2280894, L-Carnitine-methyl-d3 hydrochloride, 98 atom % D, 98% (CP)