CAS 1158508-31-6 is the registry number for 1-(5-Amino-1-methyl-1h-benzimidazol-2-yl)ethanol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-(5-amino-1-methylbenzimidazol-2-yl)ethanol;dihydrochloride (CAS 1158508-31-6) is a chemical compound with the molecular formula C10H15Cl2N3O and a molecular weight of 264.15 g/mol. IUPAC name: 1-(5-amino-1-methylbenzimidazol-2-yl)ethanol;dihydrochloride. InChIKey: YRPFNOYHACWFTH-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3O |
|---|---|
| Molecular weight | 264.15 g/mol |
| IUPAC name | 1-(5-amino-1-methylbenzimidazol-2-yl)ethanol;dihydrochloride |
| InChIKey | YRPFNOYHACWFTH-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(N1C)C=CC(=C2)N)O.Cl.Cl |
Computed by PubChem (NCBI)