CAS 1797943-04-4 appears in our catalog under these names: 1-(5-Methoxy-1H-1,3-benzodiazol-2-yl)ethan-1-amine dihydrochloride, 95%, 1-(5-Methoxy-1H-1,3-benzodiazol-2-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(6-methoxy-1H-benzimidazol-2-yl)ethanamine;dihydrochloride (CAS 1797943-04-4) is a chemical compound with the molecular formula C10H15Cl2N3O and a molecular weight of 264.15 g/mol. IUPAC name: 1-(6-methoxy-1H-benzimidazol-2-yl)ethanamine;dihydrochloride. InChIKey: IBADBJRTNDDXMY-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3O |
|---|---|
| Molecular weight | 264.15 g/mol |
| IUPAC name | 1-(6-methoxy-1H-benzimidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | IBADBJRTNDDXMY-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(N1)C=C(C=C2)OC)N.Cl.Cl |
Computed by PubChem (NCBI)