CAS 39639-99-1 appears in our catalog under these names: 1-(Pyridine-2-carbonyl)piperazine dihydrochloride, 98%, Piperazin-1-yl(pyridin-2-yl)methanone dihydrochloride, 98%, 98%, Piperazin-1-yl(pyridin-2-yl)methanone dihydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 25g, 100g, 10g.
Piperazin-1-yl(pyridin-2-yl)methanone;dihydrochloride (CAS 39639-99-1) is a chemical compound with the molecular formula C10H15Cl2N3O and a molecular weight of 264.15 g/mol. IUPAC name: piperazin-1-yl(pyridin-2-yl)methanone;dihydrochloride. InChIKey: WQWVQMOVNRBVGY-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3O |
|---|---|
| Molecular weight | 264.15 g/mol |
| IUPAC name | piperazin-1-yl(pyridin-2-yl)methanone;dihydrochloride |
| InChIKey | WQWVQMOVNRBVGY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)