CAS 32422-95-0 appears in our catalog under these names: 1-[(Pyridin-3-yl)carbonyl]piperazine dihydrochloride, 95%, Piperazin-1-yl(pyridin-3-yl)methanone dihydrochloride. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 2mg, 10mg.
Piperazin-1-yl(pyridin-3-yl)methanone;dihydrochloride (CAS 32422-95-0) is a chemical compound with the molecular formula C10H15Cl2N3O and a molecular weight of 264.15 g/mol. IUPAC name: piperazin-1-yl(pyridin-3-yl)methanone;dihydrochloride. InChIKey: GANMKWBNALJHQF-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3O |
|---|---|
| Molecular weight | 264.15 g/mol |
| IUPAC name | piperazin-1-yl(pyridin-3-yl)methanone;dihydrochloride |
| InChIKey | GANMKWBNALJHQF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)