CAS 1909287-42-8 is the registry number for rac-(4R,5S)-4-Amino-1-methyl-5-(pyridin-3-yl)pyrrolidin-2-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(4S,5R)-4-amino-1-methyl-5-pyridin-3-ylpyrrolidin-2-one;dihydrochloride (CAS 1909287-42-8) is a chemical compound with the molecular formula C10H15Cl2N3O and a molecular weight of 264.15 g/mol. IUPAC name: (4S,5R)-4-amino-1-methyl-5-pyridin-3-ylpyrrolidin-2-one;dihydrochloride. InChIKey: URTVTKVHQCXZAV-UQZKZZBYSA-N.
| Molecular formula | C10H15Cl2N3O |
|---|---|
| Molecular weight | 264.15 g/mol |
| IUPAC name | (4S,5R)-4-amino-1-methyl-5-pyridin-3-ylpyrrolidin-2-one;dihydrochloride |
| InChIKey | URTVTKVHQCXZAV-UQZKZZBYSA-N |
| SMILES | CN1[C@@H]([C@H](CC1=O)N)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)