CAS 1786215-06-2 appears in our catalog under these names: 3-Amino-6-(dimethylamino)-2,3-dihydro-1H-indol-2-one dihydrochloride, 95%, 3-Amino-6-(dimethylamino)-2,3-dihydro-1H-indol-2-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-amino-6-(dimethylamino)-1,3-dihydroindol-2-one;dihydrochloride (CAS 1786215-06-2) is a chemical compound with the molecular formula C10H15Cl2N3O and a molecular weight of 264.15 g/mol. IUPAC name: 3-amino-6-(dimethylamino)-1,3-dihydroindol-2-one;dihydrochloride. InChIKey: REUDWPSZPQVIEF-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3O |
|---|---|
| Molecular weight | 264.15 g/mol |
| IUPAC name | 3-amino-6-(dimethylamino)-1,3-dihydroindol-2-one;dihydrochloride |
| InChIKey | REUDWPSZPQVIEF-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(C(=O)N2)N.Cl.Cl |
Computed by PubChem (NCBI)