CAS 1384429-57-5 appears in our catalog under these names: 5,7-Dichloro-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%, 5,7-Dichloro-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5,7-dichloro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1384429-57-5) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: 5,7-dichloro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: HQYMFAPBRZAZFC-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | 5,7-dichloro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | HQYMFAPBRZAZFC-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CCN1)C(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)