Products 1159340-13-2

CAS 1159340-13-2 is the registry number for tert-Butyl N-(4-oxo-3,4-dihydro-2H-1-benzopyran-3-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(4-oxo-2,3-dihydrochromen-3-yl)carbamate (CAS 1159340-13-2) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: tert-butyl N-(4-oxo-2,3-dihydrochromen-3-yl)carbamate. InChIKey: BLNJOENKUFVNBG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17NO4
Molecular weight263.29 g/mol
IUPAC nametert-butyl N-(4-oxo-2,3-dihydrochromen-3-yl)carbamate
InChIKeyBLNJOENKUFVNBG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1COC2=CC=CC=C2C1=O

Computed by PubChem (NCBI)