Products 115948-90-8

CAS 115948-90-8 is the registry number for 2-(2,4-Dioxo-1,4-dihydroquinazolin-3(2h)-yl)-3-phenylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2,4-dioxo-1H-quinazolin-3-yl)-3-phenylpropanoic acid (CAS 115948-90-8) is a chemical compound with the molecular formula C17H14N2O4 and a molecular weight of 310.30 g/mol. IUPAC name: 2-(2,4-dioxo-1H-quinazolin-3-yl)-3-phenylpropanoic acid. InChIKey: JSHKCLVDTGIHEU-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O4
Molecular weight310.30 g/mol
IUPAC name2-(2,4-dioxo-1H-quinazolin-3-yl)-3-phenylpropanoic acid
InChIKeyJSHKCLVDTGIHEU-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(C(=O)O)N2C(=O)C3=CC=CC=C3NC2=O

Computed by PubChem (NCBI)