CAS 1173665-32-1 is the registry number for (R)-2-(2,4-Dioxo-1,4-dihydroquinazolin-3(2H)-yl)-3-phenylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(2,4-dioxo-1H-quinazolin-3-yl)-3-phenylpropanoic acid (CAS 1173665-32-1) is a chemical compound with the molecular formula C17H14N2O4 and a molecular weight of 310.30 g/mol. IUPAC name: (2R)-2-(2,4-dioxo-1H-quinazolin-3-yl)-3-phenylpropanoic acid. InChIKey: JSHKCLVDTGIHEU-CQSZACIVSA-N.
| Molecular formula | C17H14N2O4 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (2R)-2-(2,4-dioxo-1H-quinazolin-3-yl)-3-phenylpropanoic acid |
| InChIKey | JSHKCLVDTGIHEU-CQSZACIVSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)N2C(=O)C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)