CAS 421565-92-6 appears in our catalog under these names: 3-(4-Ethoxyphenyl)-4-oxo-3,4-dihydrophthalazine-1-carboxylic acid, 95%, 3-(4-Ethoxyphenyl)-4-oxo-3,4-dihydrophthalazine-1-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(4-ethoxyphenyl)-4-oxophthalazine-1-carboxylic acid (CAS 421565-92-6) is a chemical compound with the molecular formula C17H14N2O4 and a molecular weight of 310.30 g/mol. IUPAC name: 3-(4-ethoxyphenyl)-4-oxophthalazine-1-carboxylic acid. InChIKey: VZBKIXDHESVGNH-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 3-(4-ethoxyphenyl)-4-oxophthalazine-1-carboxylic acid |
| InChIKey | VZBKIXDHESVGNH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C(=N2)C(=O)O |
Computed by PubChem (NCBI)