CAS 1164507-38-3 is the registry number for (E)-4-Oxo-4-((2-(phenylcarbamoyl)phenyl)amino)but-2-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxo-4-[2-(phenylcarbamoyl)anilino]but-2-enoic acid (CAS 1164507-38-3) is a chemical compound with the molecular formula C17H14N2O4 and a molecular weight of 310.30 g/mol. IUPAC name: 4-oxo-4-[2-(phenylcarbamoyl)anilino]but-2-enoic acid. InChIKey: COCPWSROQBFTBZ-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 4-oxo-4-[2-(phenylcarbamoyl)anilino]but-2-enoic acid |
| InChIKey | COCPWSROQBFTBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2NC(=O)C=CC(=O)O |
Computed by PubChem (NCBI)