Products 59577-32-1

CAS 59577-32-1 is the registry number for (Z)-N-((4-Methoxybenzyloxy)carbonyloxy) benzimidoyl cyanide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

[[cyano(phenyl)methylidene]amino] (4-methoxyphenyl)methyl carbonate (CAS 59577-32-1) is a chemical compound with the molecular formula C17H14N2O4 and a molecular weight of 310.30 g/mol. IUPAC name: [[cyano(phenyl)methylidene]amino] (4-methoxyphenyl)methyl carbonate. InChIKey: IPRBOQUKBZNCAG-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O4
Molecular weight310.30 g/mol
IUPAC name[[cyano(phenyl)methylidene]amino] (4-methoxyphenyl)methyl carbonate
InChIKeyIPRBOQUKBZNCAG-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)COC(=O)ON=C(C#N)C2=CC=CC=C2

Computed by PubChem (NCBI)