Products 1189918-24-8
CAS 1189918-24-8 is the registry number for 3-Isonicotinoyl-6,7-dimethoxyquinolin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dimethoxy-3-(pyridine-4-carbonyl)-1H-quinolin-4-one (CAS 1189918-24-8) is a chemical compound with the molecular formula C17H14N2O4 and a molecular weight of 310.30 g/mol. IUPAC name: 6,7-dimethoxy-3-(pyridine-4-carbonyl)-1H-quinolin-4-one. InChIKey: SYZMCULFOJQPKE-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 6,7-dimethoxy-3-(pyridine-4-carbonyl)-1H-quinolin-4-one |
| InChIKey | SYZMCULFOJQPKE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)C3=CC=NC=C3)OC |
Computed by PubChem (NCBI)