CAS 1391361-52-6 appears in our catalog under these names: (R)-1-(4-Fluorophenyl)but-3-en-1-amine hydrochloride, 95%, (R)–1–(4–Fluorophenyl)but–3–en–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
(1R)-1-(4-fluorophenyl)but-3-en-1-amine;hydrochloride (CAS 1391361-52-6) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: (1R)-1-(4-fluorophenyl)but-3-en-1-amine;hydrochloride. InChIKey: TXYCZYDHHPXNIK-HNCPQSOCSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (1R)-1-(4-fluorophenyl)but-3-en-1-amine;hydrochloride |
| InChIKey | TXYCZYDHHPXNIK-HNCPQSOCSA-N |
| SMILES | C=CC[C@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)