CAS 1159979-34-6 appears in our catalog under these names: 6-Bromo-2-methylthieno(2,3-d)pyrimidin-4(1H)-one, 95+%, 6-Bromo-2-methyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-bromo-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 1159979-34-6) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 6-bromo-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: FPURGQYERSQEGY-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 6-bromo-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | FPURGQYERSQEGY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(S2)Br)C(=O)N1 |
Computed by PubChem (NCBI)