Products 438622-20-9
CAS 438622-20-9 appears in our catalog under these names: 7-Bromo-1h-pyrido[2,3-b][1,4]thiazin-2-one, 95%, 7-Bromo-1H-pyrido(2,3-b)(1,4)thiazin-2(3H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg.
7-bromo-1H-pyrido[2,3-b][1,4]thiazin-2-one (CAS 438622-20-9) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 7-bromo-1H-pyrido[2,3-b][1,4]thiazin-2-one. InChIKey: DCCDHDKETKOVBR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 7-bromo-1H-pyrido[2,3-b][1,4]thiazin-2-one |
| InChIKey | DCCDHDKETKOVBR-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)N=CC(=C2)Br |
Computed by PubChem (NCBI)