Products 19673-90-6
CAS 19673-90-6 appears in our catalog under these names: 6-Bromo-4-methoxy-5-methylthieno[2,3-d]pyrimidine, 95%, 6-Bromo-5-methylthieno[2,3-d]pyrimidin-4(1H)-one, 97%, 97%, 6-Bromo-5-methylthieno[2,3-d]pyrimidin-4(1H)-one, 97%, 6-bromo-5-methyl-3H,4H-thieno[2,3-d]pyrimidin-4-one, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
6-bromo-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 19673-90-6) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 6-bromo-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: ALRYVJTWOHTDPR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 6-bromo-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | ALRYVJTWOHTDPR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC=N2)Br |
Computed by PubChem (NCBI)