CAS 1259978-35-2 is the registry number for 7-Bromo-2-methoxythieno[3,2-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
7-bromo-2-methoxythieno[3,2-d]pyrimidine (CAS 1259978-35-2) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 7-bromo-2-methoxythieno[3,2-d]pyrimidine. InChIKey: QCMVNUJADNUTBT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 7-bromo-2-methoxythieno[3,2-d]pyrimidine |
| InChIKey | QCMVNUJADNUTBT-UHFFFAOYSA-N |
| SMILES | COC1=NC=C2C(=N1)C(=CS2)Br |
Computed by PubChem (NCBI)