CAS 2167804-37-5 is the registry number for 5-Bromo-2-methylthieno[2,3-d]pyrimidin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 2167804-37-5) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 5-bromo-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: DTYXYWWFJMURBN-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 5-bromo-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | DTYXYWWFJMURBN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CS2)Br)C(=O)N1 |
Computed by PubChem (NCBI)