CAS 214337-35-6 is the registry number for 2-Bromo-5-methoxy-thiazolo[5,4-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-bromo-5-methoxy-[1,3]thiazolo[5,4-b]pyridine (CAS 214337-35-6) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 2-bromo-5-methoxy-[1,3]thiazolo[5,4-b]pyridine. InChIKey: ZTRHCDBAVCPFSM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 2-bromo-5-methoxy-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | ZTRHCDBAVCPFSM-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)N=C(S2)Br |
Computed by PubChem (NCBI)