CAS 1160246-28-5 is the registry number for 1,3-Dimethyl-6-oxo-1H,6H,7H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1,3-dimethyl-6-oxo-7H-pyrazolo[5,4-b]pyridine-4-carboxylic acid (CAS 1160246-28-5) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 1,3-dimethyl-6-oxo-7H-pyrazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: AHZKOAJLIGXULD-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 1,3-dimethyl-6-oxo-7H-pyrazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | AHZKOAJLIGXULD-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=O)N2)C(=O)O)C |
Computed by PubChem (NCBI)