CAS 1160261-62-0 is the registry number for 2-Methylpyrido[2',3':3,4]pyrazolo[1,5-a]pyrimidin-4(6H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10,12-pentaen-6-one (CAS 1160261-62-0) is a chemical compound with the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. IUPAC name: 4-methyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10,12-pentaen-6-one. InChIKey: KWEKICYQHOSHIU-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | 4-methyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10,12-pentaen-6-one |
| InChIKey | KWEKICYQHOSHIU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)C3=C(N2)N=CC=C3 |
Computed by PubChem (NCBI)