CAS 2229546-16-9 is the registry number for 3-(Imidazo[1,2-a]pyridin-3-yl)isoxazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-imidazo[1,2-a]pyridin-3-yl-1,2-oxazol-5-amine (CAS 2229546-16-9) is a chemical compound with the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. IUPAC name: 3-imidazo[1,2-a]pyridin-3-yl-1,2-oxazol-5-amine. InChIKey: BAKRYLHLWIRGIS-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | 3-imidazo[1,2-a]pyridin-3-yl-1,2-oxazol-5-amine |
| InChIKey | BAKRYLHLWIRGIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1)C3=NOC(=C3)N |
Computed by PubChem (NCBI)