CAS 866149-44-2 is the registry number for 2-(5-Oxo-4-phenyl-4,5-dihydro-1h-1,2,4-triazol-1-yl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(5-oxo-4-phenyl-1,2,4-triazol-1-yl)acetonitrile (CAS 866149-44-2) is a chemical compound with the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. IUPAC name: 2-(5-oxo-4-phenyl-1,2,4-triazol-1-yl)acetonitrile. InChIKey: JOZUGJSZIAOVNS-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | 2-(5-oxo-4-phenyl-1,2,4-triazol-1-yl)acetonitrile |
| InChIKey | JOZUGJSZIAOVNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NN(C2=O)CC#N |
Computed by PubChem (NCBI)