CAS 65024-00-2 is the registry number for 6-Hydrazinyl-8-oxa-3,5-diazatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaene. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
[1]benzofuro[3,2-d]pyrimidin-4-ylhydrazine (CAS 65024-00-2) is a chemical compound with the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. IUPAC name: [1]benzofuro[3,2-d]pyrimidin-4-ylhydrazine. InChIKey: DMWZPKRPLIZDNL-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | [1]benzofuro[3,2-d]pyrimidin-4-ylhydrazine |
| InChIKey | DMWZPKRPLIZDNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=NC=N3)NN |
Computed by PubChem (NCBI)