CAS 314748-14-6 appears in our catalog under these names: 5-Hydrazinyl-2-phenyl-1,3-oxazole-4-carbonitrile, 95%, 5-Hydrazinyl-2-phenyloxazole-4-carbonitrile, 97%, 5-Hydrazinyl-2-phenyl-1,3-oxazole-4-carbonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-hydrazinyl-2-phenyl-1,3-oxazole-4-carbonitrile (CAS 314748-14-6) is a chemical compound with the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. IUPAC name: 5-hydrazinyl-2-phenyl-1,3-oxazole-4-carbonitrile. InChIKey: QIRKRPUTAYTVGW-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | 5-hydrazinyl-2-phenyl-1,3-oxazole-4-carbonitrile |
| InChIKey | QIRKRPUTAYTVGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(O2)NN)C#N |
Computed by PubChem (NCBI)