CAS 54687-66-0 is the registry number for 3-Hydroxymethyl-s-triazolo(3,4-a)phthalazine. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 2g, 1g.
[1,2,4]triazolo[3,4-a]phthalazin-3-ylmethanol (CAS 54687-66-0) is a chemical compound with the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. IUPAC name: [1,2,4]triazolo[3,4-a]phthalazin-3-ylmethanol. InChIKey: BZYKRGSMRXJBCF-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | [1,2,4]triazolo[3,4-a]phthalazin-3-ylmethanol |
| InChIKey | BZYKRGSMRXJBCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN3C2=NN=C3CO |
Computed by PubChem (NCBI)