CAS 1358959-70-2 is the registry number for 4-Oxo-4,6,7,8-tetrahydro-3h-pyrimido[4,5-b]pyrrolizine-9-carbonitrile, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1-oxo-2,6,7,8-tetrahydropyrimido[4,5-b]pyrrolizine-5-carbonitrile (CAS 1358959-70-2) is a chemical compound with the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. IUPAC name: 1-oxo-2,6,7,8-tetrahydropyrimido[4,5-b]pyrrolizine-5-carbonitrile. InChIKey: CXKOXDNOFUULOF-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | 1-oxo-2,6,7,8-tetrahydropyrimido[4,5-b]pyrrolizine-5-carbonitrile |
| InChIKey | CXKOXDNOFUULOF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=C(N2C1)C(=O)NC=N3)C#N |
Computed by PubChem (NCBI)