Products 1160264-02-7

CAS 1160264-02-7 is the registry number for (6,7-Dimethoxy-2-oxo-1,2,3,4-tetrahydroquinolin-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(6,7-dimethoxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl)acetic acid (CAS 1160264-02-7) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: 2-(6,7-dimethoxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl)acetic acid. InChIKey: MGHAPYBRWPXHSP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO5
Molecular weight265.26 g/mol
IUPAC name2-(6,7-dimethoxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl)acetic acid
InChIKeyMGHAPYBRWPXHSP-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(=C1)C(CC(=O)N2)CC(=O)O)OC

Computed by PubChem (NCBI)