Products 176787-42-1
CAS 176787-42-1 appears in our catalog under these names: Cyclohexyl (4-nitrophenyl) carbonate, 95%, cyclohexyl (4–nitrophenyl) carbonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
Cyclohexyl (4-nitrophenyl) carbonate (CAS 176787-42-1) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: cyclohexyl (4-nitrophenyl) carbonate. InChIKey: NTGDMUVJXIBLHH-UHFFFAOYSA-N.
| Molecular formula | C13H15NO5 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | cyclohexyl (4-nitrophenyl) carbonate |
| InChIKey | NTGDMUVJXIBLHH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)