Products 1160293-22-0

CAS 1160293-22-0 is the registry number for methyl 3-(methoxy(phenyl)methylene)-2-oxoindoline-6-carboxylate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-[methoxy(phenyl)methylidene]-2-oxo-1H-indole-6-carboxylate (CAS 1160293-22-0) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: methyl 3-[methoxy(phenyl)methylidene]-2-oxo-1H-indole-6-carboxylate. InChIKey: WUVZENIISJMEHI-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15NO4
Molecular weight309.3 g/mol
IUPAC namemethyl 3-[methoxy(phenyl)methylidene]-2-oxo-1H-indole-6-carboxylate
InChIKeyWUVZENIISJMEHI-UHFFFAOYSA-N
SMILESCOC(=C1C2=C(C=C(C=C2)C(=O)OC)NC1=O)C3=CC=CC=C3

Computed by PubChem (NCBI)