CAS 1160293-22-0 is the registry number for methyl 3-(methoxy(phenyl)methylene)-2-oxoindoline-6-carboxylate. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-[methoxy(phenyl)methylidene]-2-oxo-1H-indole-6-carboxylate (CAS 1160293-22-0) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: methyl 3-[methoxy(phenyl)methylidene]-2-oxo-1H-indole-6-carboxylate. InChIKey: WUVZENIISJMEHI-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | methyl 3-[methoxy(phenyl)methylidene]-2-oxo-1H-indole-6-carboxylate |
| InChIKey | WUVZENIISJMEHI-UHFFFAOYSA-N |
| SMILES | COC(=C1C2=C(C=C(C=C2)C(=O)OC)NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)