CAS 116064-77-8 appears in our catalog under these names: Dehydromiltirone, Dehydromiltirone, 99.11%. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 5 mg, 1 mg.
8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-3,4-dione (CAS 116064-77-8) is a chemical compound with the molecular formula C19H20O2 and a molecular weight of 280.4 g/mol. IUPAC name: 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-3,4-dione. InChIKey: FQRLDPKLRMEKLQ-UHFFFAOYSA-N.
| Molecular formula | C19H20O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-3,4-dione |
| InChIKey | FQRLDPKLRMEKLQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C3=C(C=C2)C(CC=C3)(C)C)C(=O)C1=O |
Computed by PubChem (NCBI)