Products 512180-03-9
CAS 512180-03-9 is the registry number for 1,3-Bis(3,5-dimethylphenyl)propane-1,3-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-bis(3,5-dimethylphenyl)propane-1,3-dione (CAS 512180-03-9) is a chemical compound with the molecular formula C19H20O2 and a molecular weight of 280.4 g/mol. IUPAC name: 1,3-bis(3,5-dimethylphenyl)propane-1,3-dione. InChIKey: GBHANBWKIDBMKX-UHFFFAOYSA-N.
| Molecular formula | C19H20O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 1,3-bis(3,5-dimethylphenyl)propane-1,3-dione |
| InChIKey | GBHANBWKIDBMKX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)CC(=O)C2=CC(=CC(=C2)C)C)C |
Computed by PubChem (NCBI)