CAS 385810-21-9 appears in our catalog under these names: 4-Butyl-4'-hydroxychalcone, 95%, 3–(4–Butylphenyl)–1–(4–hydroxyphenyl)prop–2–en–1–one, 4-Butyl-4'-hydroxychalcone, >98.0%(HPLC), 4-Butyl-4'-hydroxychalcone, ≥98%, ≥98%, 4-BUTYL-4'-HYDROXYCHALCONE, >=98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
(E)-3-(4-butylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (CAS 385810-21-9) is a chemical compound with the molecular formula C19H20O2 and a molecular weight of 280.4 g/mol. IUPAC name: (E)-3-(4-butylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: LFLVYHVGNKJGBV-NTEUORMPSA-N.
| Molecular formula | C19H20O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | (E)-3-(4-butylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | LFLVYHVGNKJGBV-NTEUORMPSA-N |
| SMILES | CCCCC1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)