CAS 360784-94-7 is the registry number for 5-(tert-Butyl)-4-hydroxy-4'-vinyl-[1,1'-biphenyl]-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-tert-butyl-5-(4-ethenylphenyl)-2-hydroxybenzaldehyde (CAS 360784-94-7) is a chemical compound with the molecular formula C19H20O2 and a molecular weight of 280.4 g/mol. IUPAC name: 3-tert-butyl-5-(4-ethenylphenyl)-2-hydroxybenzaldehyde. InChIKey: ADBDFLWGMVLXJY-UHFFFAOYSA-N.
| Molecular formula | C19H20O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 3-tert-butyl-5-(4-ethenylphenyl)-2-hydroxybenzaldehyde |
| InChIKey | ADBDFLWGMVLXJY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C=O)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)