Products 67533-76-0
CAS 67533-76-0 appears in our catalog under these names: Bis(4-(oxiran-2-ylmethyl)phenyl)methane, 95%, Bis(4–(oxiran–2–ylmethyl)phenyl)methane. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-[[4-[[4-(oxiran-2-ylmethyl)phenyl]methyl]phenyl]methyl]oxirane (CAS 67533-76-0) is a chemical compound with the molecular formula C19H20O2 and a molecular weight of 280.4 g/mol. IUPAC name: 2-[[4-[[4-(oxiran-2-ylmethyl)phenyl]methyl]phenyl]methyl]oxirane. InChIKey: ATCOEVAUHQFCNN-UHFFFAOYSA-N.
| Molecular formula | C19H20O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 2-[[4-[[4-(oxiran-2-ylmethyl)phenyl]methyl]phenyl]methyl]oxirane |
| InChIKey | ATCOEVAUHQFCNN-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC2=CC=C(C=C2)CC3=CC=C(C=C3)CC4CO4 |
Computed by PubChem (NCBI)