Products 350593-30-5
CAS 350593-30-5 appears in our catalog under these names: Chiricanine A, Chiricanine A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]benzene-1,3-diol (CAS 350593-30-5) is a chemical compound with the molecular formula C19H20O2 and a molecular weight of 280.4 g/mol. IUPAC name: 2-(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]benzene-1,3-diol. InChIKey: LJFRYKIVTYCTIO-MDZDMXLPSA-N.
| Molecular formula | C19H20O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 2-(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]benzene-1,3-diol |
| InChIKey | LJFRYKIVTYCTIO-MDZDMXLPSA-N |
| SMILES | CC(=CCC1=C(C=C(C=C1O)/C=C/C2=CC=CC=C2)O)C |
Computed by PubChem (NCBI)